| Name | Ethyl 2,4,6-trimethylbenzoate |
| Synonyms | ETHYL MESITOATE RARECHEM AL BI 0049 Ethyl-2,4,6-trimethyl Ethyl Mesitylenecarboxylate ETHYL 2,4,6-TRIMETHYLBENZOATE Ethyl 2,4,6-trimethylbenzoate Mesitylenecarboxylic Acid Ethyl Ester 2,4,6-TRIMETHYLBENZOIC ACID ETHYL ESTER Ethyl mesitoate~2,4,6-Trimethylbenzoic acid ethyl ester |
| CAS | 1754-55-8 |
| EINECS | 217-143-1 |
| InChI | InChI=1/C12H16O2/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4/h6-7H,5H2,1-4H3 |
| Molecular Formula | C12H16O2 |
| Molar Mass | 192.25 |
| Density | 1.00 |
| Boling Point | 121 °C / 7mmHg |
| Flash Point | 113.8°C |
| Water Solubility | Insoluble in water |
| Vapor Presure | 0.0143mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow to Red |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5020 |
| MDL | MFCD00015439 |
| Physical and Chemical Properties | Colorless liquid. |
| Use | Used as an intermediate in organic synthesis |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| Use | Used as an intermediate in organic synthesis |